C25H33NO4S — CID 16725337
5-[3-[(2S)-1-[4-(1-hydroxyheptyl)phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid (PubChem CID 16725337) has the molecular formula C25H33NO4S and a molecular weight of 443.61 g/mol. Its IUPAC name is 5-[3-[(2S)-1-[4-(1-hydroxyheptyl)phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(2S)-1-[4-(1-hydroxyheptyl)phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 16725337 |
| Molecular Formula | C25H33NO4S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 5-[3-[(2S)-1-[4-(1-hydroxyheptyl)phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylic acid |
| SMILES | CCCCCCC(O)c1ccc(N2C(=O)CC[C@@H]2CCCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C25H33NO4S/c1-2-3-4-5-9-22(27)18-10-12-20(13-11-18)26-19(14-17-24(26)28)7-6-8-21-15-16-23(31-21)25(29)30/h10-13,15-16,19,22,27H,2-9,14,17H2,1H3,(H,29,30)/t19-,22?/m0/s1 |
| InChIKey | MHFAQSOESHOPMP-YDNXMHBPSA-N |
| XLogP | 5.97 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|