C27H37NO4S — CID 70660624
propyl 5-[3-[(2R)-1-[4-[(1S)-1-hydroxyhexyl]phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylate (PubChem CID 70660624) has the molecular formula C27H37NO4S and a molecular weight of 471.66 g/mol. Its IUPAC name is propyl 5-[3-[(2R)-1-[4-[(1S)-1-hydroxyhexyl]phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylate.
| Compound Name | propyl 5-[3-[(2R)-1-[4-[(1S)-1-hydroxyhexyl]phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 70660624 |
| Molecular Formula | C27H37NO4S |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | propyl 5-[3-[(2R)-1-[4-[(1S)-1-hydroxyhexyl]phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylate |
| SMILES | CCCCC[C@H](O)c1ccc(N2C(=O)CC[C@H]2CCCc2ccc(C(=O)OCCC)s2)cc1 |
| InChI | InChI=1S/C27H37NO4S/c1-3-5-6-10-24(29)20-11-13-22(14-12-20)28-21(15-18-26(28)30)8-7-9-23-16-17-25(33-23)27(31)32-19-4-2/h11-14,16-17,21,24,29H,3-10,15,18-19H2,1-2H3/t21-,24+/m1/s1 |
| InChIKey | JHCPKQYGNXAIDO-QPPBQGQZSA-N |
| XLogP | 6.45 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|