C25H31NO4S — CID 76650551
methyl 5-[3-[1-[4-(1-hydroxyhexyl)phenyl]-5-oxopyrrolidin-2-yl]prop-2-enyl]thiophene-2-carboxylate (PubChem CID 76650551) has the molecular formula C25H31NO4S and a molecular weight of 441.59 g/mol. Its IUPAC name is methyl 5-[3-[1-[4-(1-hydroxyhexyl)phenyl]-5-oxopyrrolidin-2-yl]prop-2-enyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[1-[4-(1-hydroxyhexyl)phenyl]-5-oxopyrrolidin-2-yl]prop-2-enyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 76650551 |
| Molecular Formula | C25H31NO4S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | methyl 5-[3-[1-[4-(1-hydroxyhexyl)phenyl]-5-oxopyrrolidin-2-yl]prop-2-enyl]thiophene-2-carboxylate |
| SMILES | CCCCCC(O)c1ccc(N2C(=O)CCC2C=CCc2ccc(C(=O)OC)s2)cc1 |
| InChI | InChI=1S/C25H31NO4S/c1-3-4-5-9-22(27)18-10-12-20(13-11-18)26-19(14-17-24(26)28)7-6-8-21-15-16-23(31-21)25(29)30-2/h6-7,10-13,15-16,19,22,27H,3-5,8-9,14,17H2,1-2H3 |
| InChIKey | VRRFFLMGMVVCFE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|