C27H37NO5S — CID 69056439
propan-2-yl 5-[[1-[4-[(1S)-1-hydroxyheptyl]phenyl]-5-oxopyrrolidin-2-yl]-methoxymethyl]thiophene-2-carboxylate (PubChem CID 69056439) has the molecular formula C27H37NO5S and a molecular weight of 487.66 g/mol. Its IUPAC name is propan-2-yl 5-[[1-[4-[(1S)-1-hydroxyheptyl]phenyl]-5-oxopyrrolidin-2-yl]-methoxymethyl]thiophene-2-carboxylate.
| Compound Name | propan-2-yl 5-[[1-[4-[(1S)-1-hydroxyheptyl]phenyl]-5-oxopyrrolidin-2-yl]-methoxymethyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 69056439 |
| Molecular Formula | C27H37NO5S |
| Molecular Weight | 487.66 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | propan-2-yl 5-[[1-[4-[(1S)-1-hydroxyheptyl]phenyl]-5-oxopyrrolidin-2-yl]-methoxymethyl]thiophene-2-carboxylate |
| SMILES | CCCCCC[C@H](O)c1ccc(N2C(=O)CCC2C(OC)c2ccc(C(=O)OC(C)C)s2)cc1 |
| InChI | InChI=1S/C27H37NO5S/c1-5-6-7-8-9-22(29)19-10-12-20(13-11-19)28-21(14-17-25(28)30)26(32-4)23-15-16-24(34-23)27(31)33-18(2)3/h10-13,15-16,18,21-22,26,29H,5-9,14,17H2,1-4H3/t21?,22-,26?/m0/s1 |
| InChIKey | PIBDOROBZXTWKJ-HCYSDIRSSA-N |
| XLogP | 6.20 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|