C24H31NO5S — CID 68580277
5-[(R)-[1-[4-(1-hydroxyhexyl)phenyl]-6-oxopiperidin-2-yl]-methoxymethyl]thiophene-2-carboxylic acid (PubChem CID 68580277) has the molecular formula C24H31NO5S and a molecular weight of 445.58 g/mol. Its IUPAC name is 5-[(R)-[1-[4-(1-hydroxyhexyl)phenyl]-6-oxopiperidin-2-yl]-methoxymethyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(R)-[1-[4-(1-hydroxyhexyl)phenyl]-6-oxopiperidin-2-yl]-methoxymethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68580277 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 5-[(R)-[1-[4-(1-hydroxyhexyl)phenyl]-6-oxopiperidin-2-yl]-methoxymethyl]thiophene-2-carboxylic acid |
| SMILES | CCCCCC(O)c1ccc(N2C(=O)CCCC2[C@@H](OC)c2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C24H31NO5S/c1-3-4-5-8-19(26)16-10-12-17(13-11-16)25-18(7-6-9-22(25)27)23(30-2)20-14-15-21(31-20)24(28)29/h10-15,18-19,23,26H,3-9H2,1-2H3,(H,28,29)/t18?,19?,23-/m1/s1 |
| InChIKey | YOKKOGDEEMVDCY-MTNXOHHFSA-N |
| XLogP | 5.33 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|