C24H32N2O5S — CID 159072984
5-[3-[3-[4-(1-hydroxyhexyl)phenyl]-2,5-dioxoimidazolidin-4-yl]propyl]thiophene-2-carboxylic acid;methane (PubChem CID 159072984) has the molecular formula C24H32N2O5S and a molecular weight of 460.60 g/mol. Its IUPAC name is 5-[3-[3-[4-(1-hydroxyhexyl)phenyl]-2,5-dioxoimidazolidin-4-yl]propyl]thiophene-2-carboxylic acid;methane.
| Compound Name | 5-[3-[3-[4-(1-hydroxyhexyl)phenyl]-2,5-dioxoimidazolidin-4-yl]propyl]thiophene-2-carboxylic acid;methane |
|---|---|
| PubChem CID | 159072984 |
| Molecular Formula | C24H32N2O5S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 5-[3-[3-[4-(1-hydroxyhexyl)phenyl]-2,5-dioxoimidazolidin-4-yl]propyl]thiophene-2-carboxylic acid;methane |
| SMILES | C.CCCCCC(O)c1ccc(N2C(=O)NC(=O)C2CCCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C23H28N2O5S.CH4/c1-2-3-4-8-19(26)15-9-11-16(12-10-15)25-18(21(27)24-23(25)30)7-5-6-17-13-14-20(31-17)22(28)29;/h9-14,18-19,26H,2-8H2,1H3,(H,28,29)(H,24,27,30);1H4 |
| InChIKey | JZWZAXODIODCGD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|