C25H33ClO3S — CID 129084305
5-[3-[(1R,5S)-2-chloro-5-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 129084305) has the molecular formula C25H33ClO3S and a molecular weight of 449.06 g/mol. Its IUPAC name is 5-[3-[(1R,5S)-2-chloro-5-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(1R,5S)-2-chloro-5-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 129084305 |
| Molecular Formula | C25H33ClO3S |
| Molecular Weight | 449.06 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 5-[3-[(1R,5S)-2-chloro-5-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | CCCCCC(O)c1ccc([C@H]2CCC(Cl)[C@@H]2CCCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C25H33ClO3S/c1-2-3-4-8-23(27)18-11-9-17(10-12-18)20-14-15-22(26)21(20)7-5-6-19-13-16-24(30-19)25(28)29/h9-13,16,20-23,27H,2-8,14-15H2,1H3,(H,28,29)/t20-,21-,22?,23?/m1/s1 |
| InChIKey | AFTWDAOMGHVWRG-KBFCKHRLSA-N |
| XLogP | 7.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.06 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|