C22H35ClO3S — CID 89187647
5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-nonylcyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 89187647) has the molecular formula C22H35ClO3S and a molecular weight of 415.04 g/mol. Its IUPAC name is 5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-nonylcyclopentyl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-nonylcyclopentyl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 89187647 |
| Molecular Formula | C22H35ClO3S |
| Molecular Weight | 415.04 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-nonylcyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | CCCCCCCCCC1[C@@H](CCCc2ccc(C(=O)O)s2)C(Cl)C[C@H]1O |
| InChI | InChI=1S/C22H35ClO3S/c1-2-3-4-5-6-7-8-11-18-17(19(23)15-20(18)24)12-9-10-16-13-14-21(27-16)22(25)26/h13-14,17-20,24H,2-12,15H2,1H3,(H,25,26)/t17-,18?,19?,20-/m1/s1 |
| InChIKey | VOSAZQWIEFWQDH-YNIZLOQISA-N |
| XLogP | 6.51 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.04 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|