C22H33ClO4S — CID 89187628
methyl 5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]cyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 89187628) has the molecular formula C22H33ClO4S and a molecular weight of 429.02 g/mol. Its IUPAC name is methyl 5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]cyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]cyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 89187628 |
| Molecular Formula | C22H33ClO4S |
| Molecular Weight | 429.02 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | methyl 5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]cyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | CCCCCC(O)/C=C/C1[C@@H](CCCc2ccc(C(=O)OC)s2)C(Cl)C[C@H]1O |
| InChI | InChI=1S/C22H33ClO4S/c1-3-4-5-7-15(24)10-12-18-17(19(23)14-20(18)25)9-6-8-16-11-13-21(28-16)22(26)27-2/h10-13,15,17-20,24-25H,3-9,14H2,1-2H3/b12-10+/t15?,17-,18?,19?,20-/m1/s1 |
| InChIKey | MVXJFLIEGVBBEV-CIVDAZAWSA-N |
| XLogP | 4.96 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.02 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|