C27H41ClO5S — CID 89187627
methyl 5-[3-[(1R,3R)-5-chloro-2-[(E)-3-hydroxyoct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 89187627) has the molecular formula C27H41ClO5S and a molecular weight of 513.14 g/mol. Its IUPAC name is methyl 5-[3-[(1R,3R)-5-chloro-2-[(E)-3-hydroxyoct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[(1R,3R)-5-chloro-2-[(E)-3-hydroxyoct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 89187627 |
| Molecular Formula | C27H41ClO5S |
| Molecular Weight | 513.14 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | methyl 5-[3-[(1R,3R)-5-chloro-2-[(E)-3-hydroxyoct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | CCCCCC(O)/C=C/C1[C@@H](CCCc2ccc(C(=O)OC)s2)C(Cl)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C27H41ClO5S/c1-3-4-5-9-19(29)13-15-22-21(11-8-10-20-14-16-25(34-20)27(30)31-2)23(28)18-24(22)33-26-12-6-7-17-32-26/h13-16,19,21-24,26,29H,3-12,17-18H2,1-2H3/b15-13+/t19?,21-,22?,23?,24-,26?/m1/s1 |
| InChIKey | NCYKCEUUBCTUBF-UQRSFICXSA-N |
| XLogP | 6.51 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.14 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|