C21H31ClO7S2 — CID 146027088
methyl 5-[3-[(1R,2S,3S,5R)-5-chloro-2-(methylsulfonyloxymethyl)-3-(oxan-2-yloxy)cyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 146027088) has the molecular formula C21H31ClO7S2 and a molecular weight of 495.06 g/mol. Its IUPAC name is methyl 5-[3-[(1R,2S,3S,5R)-5-chloro-2-(methylsulfonyloxymethyl)-3-(oxan-2-yloxy)cyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[(1R,2S,3S,5R)-5-chloro-2-(methylsulfonyloxymethyl)-3-(oxan-2-yloxy)cyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 146027088 |
| Molecular Formula | C21H31ClO7S2 |
| Molecular Weight | 495.06 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | methyl 5-[3-[(1R,2S,3S,5R)-5-chloro-2-(methylsulfonyloxymethyl)-3-(oxan-2-yloxy)cyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CCC[C@@H]2[C@@H](COS(C)(=O)=O)[C@@H](OC3CCCCO3)C[C@H]2Cl)s1 |
| InChI | InChI=1S/C21H31ClO7S2/c1-26-21(23)19-10-9-14(30-19)6-5-7-15-16(13-28-31(2,24)25)18(12-17(15)22)29-20-8-3-4-11-27-20/h9-10,15-18,20H,3-8,11-13H2,1-2H3/t15-,16-,17-,18+,20?/m1/s1 |
| InChIKey | CFBXQRWIAOVMJD-DZJUANEXSA-N |
| XLogP | 3.99 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.06 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|