C33H55ClO6SSi — CID 67478641
methyl 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(E,3S,7S)-3-hydroxy-9-[hydroxy(dimethyl)silyl]-7,9-dimethyldec-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 67478641) has the molecular formula C33H55ClO6SSi and a molecular weight of 643.40 g/mol. Its IUPAC name is methyl 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(E,3S,7S)-3-hydroxy-9-[hydroxy(dimethyl)silyl]-7,9-dimethyldec-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(E,3S,7S)-3-hydroxy-9-[hydroxy(dimethyl)silyl]-7,9-dimethyldec-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 67478641 |
| Molecular Formula | C33H55ClO6SSi |
| Molecular Weight | 643.40 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | methyl 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(E,3S,7S)-3-hydroxy-9-[hydroxy(dimethyl)silyl]-7,9-dimethyldec-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CCC[C@@H]2[C@@H](/C=C/[C@@H](O)CCC[C@H](C)CC(C)(C)[Si](C)(C)O)[C@H](OC3CCCCO3)C[C@H]2Cl)s1 |
| InChI | InChI=1S/C33H55ClO6SSi/c1-23(22-33(2,3)42(5,6)37)11-9-12-24(35)16-18-27-26(14-10-13-25-17-19-30(41-25)32(36)38-4)28(34)21-29(27)40-31-15-7-8-20-39-31/h16-19,23-24,26-29,31,35,37H,7-15,20-22H2,1-6H3/b18-16+/t23-,24-,26+,27+,28+,29+,31?/m0/s1 |
| InChIKey | FLHVZFKOKLKVGK-YLOYDKJDSA-N |
| XLogP | 8.10 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.40 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|