C22H33ClO5S — CID 118036994
methyl 5-[3-[(1R,2S,3R,5S)-5-chloro-2-[(3S)-3,5-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 118036994) has the molecular formula C22H33ClO5S and a molecular weight of 445.02 g/mol. Its IUPAC name is methyl 5-[3-[(1R,2S,3R,5S)-5-chloro-2-[(3S)-3,5-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[(1R,2S,3R,5S)-5-chloro-2-[(3S)-3,5-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 118036994 |
| Molecular Formula | C22H33ClO5S |
| Molecular Weight | 445.02 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | methyl 5-[3-[(1R,2S,3R,5S)-5-chloro-2-[(3S)-3,5-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | CCCC(O)C[C@H](O)C=C[C@H]1[C@@H](CCCc2ccc(C(=O)OC)s2)[C@@H](Cl)C[C@H]1O |
| InChI | InChI=1S/C22H33ClO5S/c1-3-5-14(24)12-15(25)8-10-18-17(19(23)13-20(18)26)7-4-6-16-9-11-21(29-16)22(27)28-2/h8-11,14-15,17-20,24-26H,3-7,12-13H2,1-2H3/t14?,15-,17-,18+,19+,20-/m1/s1 |
| InChIKey | AWHVYKXJFFUCKM-DQNSUWBNSA-N |
| XLogP | 3.93 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.02 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|