C26H35ClO4S — CID 68585208
methyl 5-[3-[(1R,2S,3R,5S)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 68585208) has the molecular formula C26H35ClO4S and a molecular weight of 479.08 g/mol. Its IUPAC name is methyl 5-[3-[(1R,2S,3R,5S)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[(1R,2S,3R,5S)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 68585208 |
| Molecular Formula | C26H35ClO4S |
| Molecular Weight | 479.08 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | methyl 5-[3-[(1R,2S,3R,5S)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | CCCCCC(O)c1ccc([C@@H]2[C@@H](CCCc3ccc(C(=O)OC)s3)[C@@H](Cl)C[C@H]2O)cc1 |
| InChI | InChI=1S/C26H35ClO4S/c1-3-4-5-9-22(28)17-10-12-18(13-11-17)25-20(21(27)16-23(25)29)8-6-7-19-14-15-24(32-19)26(30)31-2/h10-15,20-23,25,28-29H,3-9,16H2,1-2H3/t20-,21-,22?,23+,25+/m0/s1 |
| InChIKey | RCTCWKDGDGPJFM-BXSPSTCZSA-N |
| XLogP | 6.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.08 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|