C21H31ClO5S — CID 143879871
5-[3-[(1R,3R)-5-chloro-2-[(E,3S)-3,7-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 143879871) has the molecular formula C21H31ClO5S and a molecular weight of 430.99 g/mol. Its IUPAC name is 5-[3-[(1R,3R)-5-chloro-2-[(E,3S)-3,7-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(1R,3R)-5-chloro-2-[(E,3S)-3,7-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 143879871 |
| Molecular Formula | C21H31ClO5S |
| Molecular Weight | 430.99 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 5-[3-[(1R,3R)-5-chloro-2-[(E,3S)-3,7-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | CC(O)CCC[C@H](O)/C=C/C1[C@@H](CCCc2ccc(C(=O)O)s2)C(Cl)C[C@H]1O |
| InChI | InChI=1S/C21H31ClO5S/c1-13(23)4-2-5-14(24)8-10-17-16(18(22)12-19(17)25)7-3-6-15-9-11-20(28-15)21(26)27/h8-11,13-14,16-19,23-25H,2-7,12H2,1H3,(H,26,27)/b10-8+/t13?,14-,16+,17?,18?,19+/m0/s1 |
| InChIKey | VXSRPAQNHPYETH-MJCMXRGSSA-N |
| XLogP | 3.84 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.99 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|