C20H29ClO4S — CID 173487594
5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-(7-hydroxyhept-1-enyl)cyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 173487594) has the molecular formula C20H29ClO4S and a molecular weight of 400.97 g/mol. Its IUPAC name is 5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-(7-hydroxyhept-1-enyl)cyclopentyl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-(7-hydroxyhept-1-enyl)cyclopentyl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 173487594 |
| Molecular Formula | C20H29ClO4S |
| Molecular Weight | 400.97 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-(7-hydroxyhept-1-enyl)cyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCC[C@H]2C(Cl)C[C@@H](O)C2C=CCCCCCO)s1 |
| InChI | InChI=1S/C20H29ClO4S/c21-17-13-18(23)16(8-4-2-1-3-5-12-22)15(17)9-6-7-14-10-11-19(26-14)20(24)25/h4,8,10-11,15-18,22-23H,1-3,5-7,9,12-13H2,(H,24,25)/t15-,16?,17?,18-/m1/s1 |
| InChIKey | BFMIXIZGHNEHAY-AQEOSJORSA-N |
| XLogP | 4.48 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.97 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|