C34H48ClIO3S — CID 162268145
5-[3-[(1R,2R,3R,5R)-5-chloro-2-(2-cyclopentylethenyl)-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid;ethynylcyclopentane;[(E)-2-iodoethenyl]cyclopentane (PubChem CID 162268145) has the molecular formula C34H48ClIO3S and a molecular weight of 699.18 g/mol. Its IUPAC name is 5-[3-[(1R,2R,3R,5R)-5-chloro-2-(2-cyclopentylethenyl)-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid;ethynylcyclopentane;[(E)-2-iodoethenyl]cyclopentane.
| Compound Name | 5-[3-[(1R,2R,3R,5R)-5-chloro-2-(2-cyclopentylethenyl)-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid;ethynylcyclopentane;[(E)-2-iodoethenyl]cyclopentane |
|---|---|
| PubChem CID | 162268145 |
| Molecular Formula | C34H48ClIO3S |
| Molecular Weight | 699.18 g/mol |
| Exact Mass | 698.21 |
| IUPAC Name | 5-[3-[(1R,2R,3R,5R)-5-chloro-2-(2-cyclopentylethenyl)-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid;ethynylcyclopentane;[(E)-2-iodoethenyl]cyclopentane |
| SMILES | C#CC1CCCC1.I/C=C/C1CCCC1.O=C(O)c1ccc(CCC[C@@H]2[C@@H](C=CC3CCCC3)[C@H](O)C[C@H]2Cl)s1 |
| InChI | InChI=1S/C20H27ClO3S.C7H11I.C7H10/c21-17-12-18(22)16(10-8-13-4-1-2-5-13)15(17)7-3-6-14-9-11-19(25-14)20(23)24;8-6-5-7-3-1-2-4-7;1-2-7-5-3-4-6-7/h8-11,13,15-18,22H,1-7,12H2,(H,23,24);5-7H,1-4H2;1,7H,3-6H2/b;6-5+;/t15-,16-,17-,18-;;/m1../s1 |
| InChIKey | WBHLIHZNIIWMKX-ZLIMDSIZSA-N |
| XLogP | 10.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.18 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|