C21H21Cl2NO5S — CID 58184424
4-[(E)-2-[(1R,2R,3R,5R)-2-[3-(5-carboxythiophen-2-yl)propyl]-3-chloro-5-hydroxycyclopentyl]ethenyl]-6-chloropyridine-2-carboxylic acid (PubChem CID 58184424) has the molecular formula C21H21Cl2NO5S and a molecular weight of 470.37 g/mol. Its IUPAC name is 4-[(E)-2-[(1R,2R,3R,5R)-2-[3-(5-carboxythiophen-2-yl)propyl]-3-chloro-5-hydroxycyclopentyl]ethenyl]-6-chloropyridine-2-carboxylic acid.
| Compound Name | 4-[(E)-2-[(1R,2R,3R,5R)-2-[3-(5-carboxythiophen-2-yl)propyl]-3-chloro-5-hydroxycyclopentyl]ethenyl]-6-chloropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58184424 |
| Molecular Formula | C21H21Cl2NO5S |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 4-[(E)-2-[(1R,2R,3R,5R)-2-[3-(5-carboxythiophen-2-yl)propyl]-3-chloro-5-hydroxycyclopentyl]ethenyl]-6-chloropyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc(/C=C/[C@@H]2[C@@H](CCCc3ccc(C(=O)O)s3)[C@H](Cl)C[C@H]2O)cc(Cl)n1 |
| InChI | InChI=1S/C21H21Cl2NO5S/c22-15-10-17(25)14(6-4-11-8-16(20(26)27)24-19(23)9-11)13(15)3-1-2-12-5-7-18(30-12)21(28)29/h4-9,13-15,17,25H,1-3,10H2,(H,26,27)(H,28,29)/b6-4+/t13-,14-,15-,17-/m1/s1 |
| InChIKey | OAOVTNDLVLQESP-NTYUJXGYSA-N |
| XLogP | 4.83 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|