C20H22Cl3NO3S — CID 74320156
5-[3-[5-chloro-2-[2-(2,6-dichloro-4-pyridinyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 74320156) has the molecular formula C20H22Cl3NO3S and a molecular weight of 462.83 g/mol. Its IUPAC name is 5-[3-[5-chloro-2-[2-(2,6-dichloro-4-pyridinyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[5-chloro-2-[2-(2,6-dichloro-4-pyridinyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 74320156 |
| Molecular Formula | C20H22Cl3NO3S |
| Molecular Weight | 462.83 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 5-[3-[5-chloro-2-[2-(2,6-dichloro-4-pyridinyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCCC2C(Cl)CC(O)C2CCc2cc(Cl)nc(Cl)c2)s1 |
| InChI | InChI=1S/C20H22Cl3NO3S/c21-15-10-16(25)14(6-4-11-8-18(22)24-19(23)9-11)13(15)3-1-2-12-5-7-17(28-12)20(26)27/h5,7-9,13-16,25H,1-4,6,10H2,(H,26,27) |
| InChIKey | ABVSNACOXNNDRK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.83 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|