C29H32Cl3NO3S — CID 118514992
[4-(dimethylamino)phenyl] 5-[3-[5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 118514992) has the molecular formula C29H32Cl3NO3S and a molecular weight of 581.01 g/mol. Its IUPAC name is [4-(dimethylamino)phenyl] 5-[3-[5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | [4-(dimethylamino)phenyl] 5-[3-[5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 118514992 |
| Molecular Formula | C29H32Cl3NO3S |
| Molecular Weight | 581.01 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | [4-(dimethylamino)phenyl] 5-[3-[5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | CN(C)c1ccc(OC(=O)c2ccc(CCCC3C(Cl)CC(O)C3CCc3cc(Cl)cc(Cl)c3)s2)cc1 |
| InChI | InChI=1S/C29H32Cl3NO3S/c1-33(2)21-7-9-22(10-8-21)36-29(35)28-13-11-23(37-28)4-3-5-24-25(27(34)17-26(24)32)12-6-18-14-19(30)16-20(31)15-18/h7-11,13-16,24-27,34H,3-6,12,17H2,1-2H3 |
| InChIKey | YWKHNZFOOXHBTO-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.01 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|