C32H36Cl3NO4S — CID 118531005
[4-[acetyl(propyl)amino]phenyl] 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 118531005) has the molecular formula C32H36Cl3NO4S and a molecular weight of 637.07 g/mol. Its IUPAC name is [4-[acetyl(propyl)amino]phenyl] 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | [4-[acetyl(propyl)amino]phenyl] 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 118531005 |
| Molecular Formula | C32H36Cl3NO4S |
| Molecular Weight | 637.07 g/mol |
| Exact Mass | 635.14 |
| IUPAC Name | [4-[acetyl(propyl)amino]phenyl] 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | CCCN(C(C)=O)c1ccc(OC(=O)c2ccc(CCC[C@@H]3[C@@H](CCc4cc(Cl)cc(Cl)c4)[C@H](O)C[C@H]3Cl)s2)cc1 |
| InChI | InChI=1S/C32H36Cl3NO4S/c1-3-15-36(20(2)37)24-8-10-25(11-9-24)40-32(39)31-14-12-26(41-31)5-4-6-27-28(30(38)19-29(27)35)13-7-21-16-22(33)18-23(34)17-21/h8-12,14,16-18,27-30,38H,3-7,13,15,19H2,1-2H3/t27-,28-,29-,30-/m1/s1 |
| InChIKey | HMLSGIHKNADRAN-SKKKGAJSSA-N |
| XLogP | 8.60 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.07 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|