C30H34Cl3NO3S — CID 126709703
[4-[(dimethylamino)methyl]phenyl] 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 126709703) has the molecular formula C30H34Cl3NO3S and a molecular weight of 595.03 g/mol. Its IUPAC name is [4-[(dimethylamino)methyl]phenyl] 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | [4-[(dimethylamino)methyl]phenyl] 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 126709703 |
| Molecular Formula | C30H34Cl3NO3S |
| Molecular Weight | 595.03 g/mol |
| Exact Mass | 593.13 |
| IUPAC Name | [4-[(dimethylamino)methyl]phenyl] 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | CN(C)Cc1ccc(OC(=O)c2ccc(CCC[C@@H]3[C@@H](CCc4cc(Cl)cc(Cl)c4)[C@H](O)C[C@H]3Cl)s2)cc1 |
| InChI | InChI=1S/C30H34Cl3NO3S/c1-34(2)18-19-6-9-23(10-7-19)37-30(36)29-13-11-24(38-29)4-3-5-25-26(28(35)17-27(25)33)12-8-20-14-21(31)16-22(32)15-20/h6-7,9-11,13-16,25-28,35H,3-5,8,12,17-18H2,1-2H3/t25-,26-,27-,28-/m1/s1 |
| InChIKey | IZKIICNORMCRNV-BIYDSLDMSA-N |
| XLogP | 7.90 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.03 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|