C22H24Cl2O4S — CID 44512833
5-[3-[(1R,2R,3R,5R)-2-[(E)-3-(3,5-dichlorophenyl)prop-1-enyl]-3,5-dihydroxycyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 44512833) has the molecular formula C22H24Cl2O4S and a molecular weight of 455.40 g/mol. Its IUPAC name is 5-[3-[(1R,2R,3R,5R)-2-[(E)-3-(3,5-dichlorophenyl)prop-1-enyl]-3,5-dihydroxycyclopentyl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(1R,2R,3R,5R)-2-[(E)-3-(3,5-dichlorophenyl)prop-1-enyl]-3,5-dihydroxycyclopentyl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 44512833 |
| Molecular Formula | C22H24Cl2O4S |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 5-[3-[(1R,2R,3R,5R)-2-[(E)-3-(3,5-dichlorophenyl)prop-1-enyl]-3,5-dihydroxycyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCC[C@@H]2[C@@H](/C=C/Cc3cc(Cl)cc(Cl)c3)[C@H](O)C[C@H]2O)s1 |
| InChI | InChI=1S/C22H24Cl2O4S/c23-14-9-13(10-15(24)11-14)3-1-5-17-18(20(26)12-19(17)25)6-2-4-16-7-8-21(29-16)22(27)28/h1,5,7-11,17-20,25-26H,2-4,6,12H2,(H,27,28)/b5-1+/t17-,18-,19-,20-/m1/s1 |
| InChIKey | HXACGUKLYBYKGF-MHLLWIHZSA-N |
| XLogP | 5.23 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|