C20H20Cl3NO4S — CID 89420431
[5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(Z)-2-(2,6-dichloro-4-pyridinyl)ethenyl]-3-hydroxycyclopentyl]propyl]thiophen-2-yl] hydrogen carbonate (PubChem CID 89420431) has the molecular formula C20H20Cl3NO4S and a molecular weight of 476.81 g/mol. Its IUPAC name is [5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(Z)-2-(2,6-dichloro-4-pyridinyl)ethenyl]-3-hydroxycyclopentyl]propyl]thiophen-2-yl] hydrogen carbonate.
| Compound Name | [5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(Z)-2-(2,6-dichloro-4-pyridinyl)ethenyl]-3-hydroxycyclopentyl]propyl]thiophen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 89420431 |
| Molecular Formula | C20H20Cl3NO4S |
| Molecular Weight | 476.81 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | [5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(Z)-2-(2,6-dichloro-4-pyridinyl)ethenyl]-3-hydroxycyclopentyl]propyl]thiophen-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc(CCC[C@@H]2[C@@H](/C=C\c3cc(Cl)nc(Cl)c3)[C@H](O)C[C@H]2Cl)s1 |
| InChI | InChI=1S/C20H20Cl3NO4S/c21-15-10-16(25)14(6-4-11-8-17(22)24-18(23)9-11)13(15)3-1-2-12-5-7-19(29-12)28-20(26)27/h4-9,13-16,25H,1-3,10H2,(H,26,27)/b6-4-/t13-,14-,15-,16-/m1/s1 |
| InChIKey | OSPJYKJPDNFEBF-ASAKMOIOSA-N |
| XLogP | 6.15 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.81 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|