C23H35ClO5S — CID 121278725
methyl 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(3S,8R)-3,8-dihydroxynon-1-enyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 121278725) has the molecular formula C23H35ClO5S and a molecular weight of 459.05 g/mol. Its IUPAC name is methyl 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(3S,8R)-3,8-dihydroxynon-1-enyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(3S,8R)-3,8-dihydroxynon-1-enyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 121278725 |
| Molecular Formula | C23H35ClO5S |
| Molecular Weight | 459.05 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | methyl 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(3S,8R)-3,8-dihydroxynon-1-enyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CCC[C@@H]2[C@@H](C=C[C@@H](O)CCCC[C@@H](C)O)[C@H](O)C[C@H]2Cl)s1 |
| InChI | InChI=1S/C23H35ClO5S/c1-15(25)6-3-4-7-16(26)10-12-19-18(20(24)14-21(19)27)9-5-8-17-11-13-22(30-17)23(28)29-2/h10-13,15-16,18-21,25-27H,3-9,14H2,1-2H3/t15-,16+,18-,19-,20-,21-/m1/s1 |
| InChIKey | DPNZZGQSRLYWRK-DAHSGPHPSA-N |
| XLogP | 4.32 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.05 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|