C17H27ClOS — CID 141316963
(1R,2R,3R,4R)-4-chloro-2-pentyl-3-(3-thiophen-2-ylpropyl)cyclopentan-1-ol (PubChem CID 141316963) has the molecular formula C17H27ClOS and a molecular weight of 314.92 g/mol. Its IUPAC name is (1R,2R,3R,4R)-4-chloro-2-pentyl-3-(3-thiophen-2-ylpropyl)cyclopentan-1-ol.
| Compound Name | (1R,2R,3R,4R)-4-chloro-2-pentyl-3-(3-thiophen-2-ylpropyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 141316963 |
| Molecular Formula | C17H27ClOS |
| Molecular Weight | 314.92 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (1R,2R,3R,4R)-4-chloro-2-pentyl-3-(3-thiophen-2-ylpropyl)cyclopentan-1-ol |
| SMILES | CCCCC[C@@H]1[C@@H](CCCc2cccs2)[C@H](Cl)C[C@H]1O |
| InChI | InChI=1S/C17H27ClOS/c1-2-3-4-9-15-14(16(18)12-17(15)19)10-5-7-13-8-6-11-20-13/h6,8,11,14-17,19H,2-5,7,9-10,12H2,1H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | UZELDURIKDYHLX-QBPKDAKJSA-N |
| XLogP | 5.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.92 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|