C23H31ClO2 — CID 143902617
cis-(1R,3R)-4-chloro-3-heptyl-2-(naphthalen-2-yloxymethyl)cyclopentan-1-ol (PubChem CID 143902617) has the molecular formula C23H31ClO2 and a molecular weight of 374.95 g/mol. Its IUPAC name is cis-(1R,3R)-4-chloro-3-heptyl-2-(naphthalen-2-yloxymethyl)cyclopentan-1-ol.
| Compound Name | cis-(1R,3R)-4-chloro-3-heptyl-2-(naphthalen-2-yloxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 143902617 |
| Molecular Formula | C23H31ClO2 |
| Molecular Weight | 374.95 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | cis-(1R,3R)-4-chloro-3-heptyl-2-(naphthalen-2-yloxymethyl)cyclopentan-1-ol |
| SMILES | CCCCCCC[C@H]1C(Cl)C[C@@H](O)C1COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H31ClO2/c1-2-3-4-5-6-11-20-21(23(25)15-22(20)24)16-26-19-13-12-17-9-7-8-10-18(17)14-19/h7-10,12-14,20-23,25H,2-6,11,15-16H2,1H3/t20-,21?,22?,23-/m1/s1 |
| InChIKey | ZOTPOCUAECEDGL-WYZYGFAWSA-N |
| XLogP | 6.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.95 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|