C24H41ClO3S — CID 89190435
propan-2-yl 5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-octylcyclopentyl]propyl]-2,3-dihydrothiophene-2-carboxylate (PubChem CID 89190435) has the molecular formula C24H41ClO3S and a molecular weight of 445.11 g/mol. Its IUPAC name is propan-2-yl 5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-octylcyclopentyl]propyl]-2,3-dihydrothiophene-2-carboxylate.
| Compound Name | propan-2-yl 5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-octylcyclopentyl]propyl]-2,3-dihydrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 89190435 |
| Molecular Formula | C24H41ClO3S |
| Molecular Weight | 445.11 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | propan-2-yl 5-[3-[(1R,3R)-5-chloro-3-hydroxy-2-octylcyclopentyl]propyl]-2,3-dihydrothiophene-2-carboxylate |
| SMILES | CCCCCCCCC1[C@@H](CCCC2=CCC(C(=O)OC(C)C)S2)C(Cl)C[C@H]1O |
| InChI | InChI=1S/C24H41ClO3S/c1-4-5-6-7-8-9-12-20-19(21(25)16-22(20)26)13-10-11-18-14-15-23(29-18)24(27)28-17(2)3/h14,17,19-23,26H,4-13,15-16H2,1-3H3/t19-,20?,21?,22-,23?/m1/s1 |
| InChIKey | YVOUGLMNVRFLNL-BVHRVAMWSA-N |
| XLogP | 6.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.11 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|