C18H29ClOS — CID 141316966
(1R,2R,3R,4R)-4-chloro-2-hexyl-3-(3-thiophen-2-ylpropyl)cyclopentan-1-ol (PubChem CID 141316966) has the molecular formula C18H29ClOS and a molecular weight of 328.95 g/mol. Its IUPAC name is (1R,2R,3R,4R)-4-chloro-2-hexyl-3-(3-thiophen-2-ylpropyl)cyclopentan-1-ol.
| Compound Name | (1R,2R,3R,4R)-4-chloro-2-hexyl-3-(3-thiophen-2-ylpropyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 141316966 |
| Molecular Formula | C18H29ClOS |
| Molecular Weight | 328.95 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (1R,2R,3R,4R)-4-chloro-2-hexyl-3-(3-thiophen-2-ylpropyl)cyclopentan-1-ol |
| SMILES | CCCCCC[C@@H]1[C@@H](CCCc2cccs2)[C@H](Cl)C[C@H]1O |
| InChI | InChI=1S/C18H29ClOS/c1-2-3-4-5-10-16-15(17(19)13-18(16)20)11-6-8-14-9-7-12-21-14/h7,9,12,15-18,20H,2-6,8,10-11,13H2,1H3/t15-,16-,17-,18-/m1/s1 |
| InChIKey | ACCVJDBWGFUOBO-BRSBDYLESA-N |
| XLogP | 5.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.95 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|