C19H22Cl3NOS — CID 58358352
(1R,2S,3R,4R)-4-chloro-2-[(3,5-dichloroanilino)methyl]-3-(3-thiophen-2-ylpropyl)cyclopentan-1-ol (PubChem CID 58358352) has the molecular formula C19H22Cl3NOS and a molecular weight of 418.82 g/mol. Its IUPAC name is (1R,2S,3R,4R)-4-chloro-2-[(3,5-dichloroanilino)methyl]-3-(3-thiophen-2-ylpropyl)cyclopentan-1-ol.
| Compound Name | (1R,2S,3R,4R)-4-chloro-2-[(3,5-dichloroanilino)methyl]-3-(3-thiophen-2-ylpropyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 58358352 |
| Molecular Formula | C19H22Cl3NOS |
| Molecular Weight | 418.82 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | (1R,2S,3R,4R)-4-chloro-2-[(3,5-dichloroanilino)methyl]-3-(3-thiophen-2-ylpropyl)cyclopentan-1-ol |
| SMILES | O[C@@H]1C[C@@H](Cl)[C@H](CCCc2cccs2)[C@H]1CNc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H22Cl3NOS/c20-12-7-13(21)9-14(8-12)23-11-17-16(18(22)10-19(17)24)5-1-3-15-4-2-6-25-15/h2,4,6-9,16-19,23-24H,1,3,5,10-11H2/t16-,17-,18-,19-/m1/s1 |
| InChIKey | FBDSIEGTKKJRMI-NCXUSEDFSA-N |
| XLogP | 6.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.82 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|