C12H11Cl2NS — CID 63773799
2,4-dichloro-N-(2-thiophen-2-ylethyl)aniline (PubChem CID 63773799) has the molecular formula C12H11Cl2NS and a molecular weight of 272.20 g/mol. Its IUPAC name is 2,4-dichloro-N-(2-thiophen-2-ylethyl)aniline.
| Compound Name | 2,4-dichloro-N-(2-thiophen-2-ylethyl)aniline |
|---|---|
| PubChem CID | 63773799 |
| Molecular Formula | C12H11Cl2NS |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 2,4-dichloro-N-(2-thiophen-2-ylethyl)aniline |
| SMILES | Clc1ccc(NCCc2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2NS/c13-9-3-4-12(11(14)8-9)15-6-5-10-2-1-7-16-10/h1-4,7-8,15H,5-6H2 |
| InChIKey | DAFZWCJUDBILEZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |