C23H29ClO4S — CID 89328080
5-[[2-chloro-5-[4-(1-hydroxypentyl)phenyl]cyclopentyl]methoxymethyl]thiophene-2-carboxylic acid (PubChem CID 89328080) has the molecular formula C23H29ClO4S and a molecular weight of 437.00 g/mol. Its IUPAC name is 5-[[2-chloro-5-[4-(1-hydroxypentyl)phenyl]cyclopentyl]methoxymethyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[2-chloro-5-[4-(1-hydroxypentyl)phenyl]cyclopentyl]methoxymethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 89328080 |
| Molecular Formula | C23H29ClO4S |
| Molecular Weight | 437.00 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 5-[[2-chloro-5-[4-(1-hydroxypentyl)phenyl]cyclopentyl]methoxymethyl]thiophene-2-carboxylic acid |
| SMILES | CCCCC(O)c1ccc(C2CCC(Cl)C2COCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C23H29ClO4S/c1-2-3-4-21(25)16-7-5-15(6-8-16)18-10-11-20(24)19(18)14-28-13-17-9-12-22(29-17)23(26)27/h5-9,12,18-21,25H,2-4,10-11,13-14H2,1H3,(H,26,27) |
| InChIKey | JBQSLZPQLIYQRG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.00 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|