C23H30ClNO3S — CID 148785847
5-[[(2S,3R)-3-chloro-1-(4-hexylphenyl)pyrrolidin-2-yl]methoxymethyl]thiophene-2-carboxylic acid (PubChem CID 148785847) has the molecular formula C23H30ClNO3S and a molecular weight of 436.02 g/mol. Its IUPAC name is 5-[[(2S,3R)-3-chloro-1-(4-hexylphenyl)pyrrolidin-2-yl]methoxymethyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[(2S,3R)-3-chloro-1-(4-hexylphenyl)pyrrolidin-2-yl]methoxymethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 148785847 |
| Molecular Formula | C23H30ClNO3S |
| Molecular Weight | 436.02 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 5-[[(2S,3R)-3-chloro-1-(4-hexylphenyl)pyrrolidin-2-yl]methoxymethyl]thiophene-2-carboxylic acid |
| SMILES | CCCCCCc1ccc(N2CC[C@@H](Cl)[C@@H]2COCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C23H30ClNO3S/c1-2-3-4-5-6-17-7-9-18(10-8-17)25-14-13-20(24)21(25)16-28-15-19-11-12-22(29-19)23(26)27/h7-12,20-21H,2-6,13-16H2,1H3,(H,26,27)/t20-,21+/m1/s1 |
| InChIKey | HHADXCCQBYPUGG-RTWAWAEBSA-N |
| XLogP | 5.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.02 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|