C24H33NO3S2 — CID 143636457
5-[3-[3-(4-hexylphenyl)-4-oxo-1,3-thiazolidin-2-yl]propyl]thiophene-2-carboxylic acid;methane (PubChem CID 143636457) has the molecular formula C24H33NO3S2 and a molecular weight of 447.67 g/mol. Its IUPAC name is 5-[3-[3-(4-hexylphenyl)-4-oxo-1,3-thiazolidin-2-yl]propyl]thiophene-2-carboxylic acid;methane.
| Compound Name | 5-[3-[3-(4-hexylphenyl)-4-oxo-1,3-thiazolidin-2-yl]propyl]thiophene-2-carboxylic acid;methane |
|---|---|
| PubChem CID | 143636457 |
| Molecular Formula | C24H33NO3S2 |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 5-[3-[3-(4-hexylphenyl)-4-oxo-1,3-thiazolidin-2-yl]propyl]thiophene-2-carboxylic acid;methane |
| SMILES | C.CCCCCCc1ccc(N2C(=O)CSC2CCCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C23H29NO3S2.CH4/c1-2-3-4-5-7-17-10-12-18(13-11-17)24-21(25)16-28-22(24)9-6-8-19-14-15-20(29-19)23(26)27;/h10-15,22H,2-9,16H2,1H3,(H,26,27);1H4 |
| InChIKey | SZERZAGSDRYHIB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|