C28H30N2O2S — CID 93123921
4-hexyl-N-[4-[(2R)-4-oxo-3-phenyl-1,3-thiazolidin-2-yl]phenyl]benzamide (PubChem CID 93123921) has the molecular formula C28H30N2O2S and a molecular weight of 458.63 g/mol. Its IUPAC name is 4-hexyl-N-[4-[(2R)-4-oxo-3-phenyl-1,3-thiazolidin-2-yl]phenyl]benzamide.
| Compound Name | 4-hexyl-N-[4-[(2R)-4-oxo-3-phenyl-1,3-thiazolidin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 93123921 |
| Molecular Formula | C28H30N2O2S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 4-hexyl-N-[4-[(2R)-4-oxo-3-phenyl-1,3-thiazolidin-2-yl]phenyl]benzamide |
| SMILES | CCCCCCc1ccc(C(=O)Nc2ccc([C@H]3SCC(=O)N3c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H30N2O2S/c1-2-3-4-6-9-21-12-14-22(15-13-21)27(32)29-24-18-16-23(17-19-24)28-30(26(31)20-33-28)25-10-7-5-8-11-25/h5,7-8,10-19,28H,2-4,6,9,20H2,1H3,(H,29,32)/t28-/m1/s1 |
| InChIKey | XBAVXLSCWKPEPS-MUUNZHRXSA-N |
| XLogP | 6.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|