C29H30N2O4S — CID 42807186
N-[4-[3-(1,3-benzodioxol-5-yl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-4-hexylbenzamide (PubChem CID 42807186) has the molecular formula C29H30N2O4S and a molecular weight of 502.64 g/mol. Its IUPAC name is N-[4-[3-(1,3-benzodioxol-5-yl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-4-hexylbenzamide.
| Compound Name | N-[4-[3-(1,3-benzodioxol-5-yl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-4-hexylbenzamide |
|---|---|
| PubChem CID | 42807186 |
| Molecular Formula | C29H30N2O4S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | N-[4-[3-(1,3-benzodioxol-5-yl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-4-hexylbenzamide |
| SMILES | CCCCCCc1ccc(C(=O)Nc2ccc(C3SCC(=O)N3c3ccc4c(c3)OCO4)cc2)cc1 |
| InChI | InChI=1S/C29H30N2O4S/c1-2-3-4-5-6-20-7-9-21(10-8-20)28(33)30-23-13-11-22(12-14-23)29-31(27(32)18-36-29)24-15-16-25-26(17-24)35-19-34-25/h7-17,29H,2-6,18-19H2,1H3,(H,30,33) |
| InChIKey | XMCZKAZVHGXHPM-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|