C28H30N2O3S — CID 93125813
4-butoxy-N-[4-[(2R)-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide (PubChem CID 93125813) has the molecular formula C28H30N2O3S and a molecular weight of 474.63 g/mol. Its IUPAC name is 4-butoxy-N-[4-[(2R)-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide.
| Compound Name | 4-butoxy-N-[4-[(2R)-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 93125813 |
| Molecular Formula | C28H30N2O3S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 4-butoxy-N-[4-[(2R)-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc([C@H]3SCC(=O)N3c3ccc(C)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C28H30N2O3S/c1-4-5-16-33-25-14-9-21(10-15-25)27(32)29-23-11-7-22(8-12-23)28-30(26(31)18-34-28)24-13-6-19(2)20(3)17-24/h6-15,17,28H,4-5,16,18H2,1-3H3,(H,29,32)/t28-/m1/s1 |
| InChIKey | YPZSKASLPDYLKH-MUUNZHRXSA-N |
| XLogP | 6.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|