C26H25FN2O3S — CID 42667006
4-butoxy-N-[4-[3-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide (PubChem CID 42667006) has the molecular formula C26H25FN2O3S and a molecular weight of 464.56 g/mol. Its IUPAC name is 4-butoxy-N-[4-[3-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide.
| Compound Name | 4-butoxy-N-[4-[3-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 42667006 |
| Molecular Formula | C26H25FN2O3S |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 4-butoxy-N-[4-[3-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(C3SCC(=O)N3c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H25FN2O3S/c1-2-3-16-32-23-14-6-18(7-15-23)25(31)28-21-10-4-19(5-11-21)26-29(24(30)17-33-26)22-12-8-20(27)9-13-22/h4-15,26H,2-3,16-17H2,1H3,(H,28,31) |
| InChIKey | AGWWFSSFWOQXMF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|