C27H28N2O4S — CID 93125878
4-butoxy-N-[3-[(2S)-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide (PubChem CID 93125878) has the molecular formula C27H28N2O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is 4-butoxy-N-[3-[(2S)-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide.
| Compound Name | 4-butoxy-N-[3-[(2S)-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 93125878 |
| Molecular Formula | C27H28N2O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 4-butoxy-N-[3-[(2S)-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2cccc([C@@H]3SCC(=O)N3c3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C27H28N2O4S/c1-3-4-16-33-24-12-8-19(9-13-24)26(31)28-21-7-5-6-20(17-21)27-29(25(30)18-34-27)22-10-14-23(32-2)15-11-22/h5-15,17,27H,3-4,16,18H2,1-2H3,(H,28,31)/t27-/m0/s1 |
| InChIKey | QHYQZHMADCCONZ-MHZLTWQESA-N |
| XLogP | 5.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|