C28H30N2O4S — CID 93125732
4-butoxy-N-[3-[(2S)-3-(4-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide (PubChem CID 93125732) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is 4-butoxy-N-[3-[(2S)-3-(4-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide.
| Compound Name | 4-butoxy-N-[3-[(2S)-3-(4-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 93125732 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 4-butoxy-N-[3-[(2S)-3-(4-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2cccc([C@@H]3SCC(=O)N3c3ccc(OCC)cc3)c2)cc1 |
| InChI | InChI=1S/C28H30N2O4S/c1-3-5-17-34-25-13-9-20(10-14-25)27(32)29-22-8-6-7-21(18-22)28-30(26(31)19-35-28)23-11-15-24(16-12-23)33-4-2/h6-16,18,28H,3-5,17,19H2,1-2H3,(H,29,32)/t28-/m0/s1 |
| InChIKey | GQEHBSKDKRXIHE-NDEPHWFRSA-N |
| XLogP | 6.30 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|