C23H20N2O3S — CID 42804066
3-methoxy-N-[4-(4-oxo-3-phenyl-1,3-thiazolidin-2-yl)phenyl]benzamide (PubChem CID 42804066) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is 3-methoxy-N-[4-(4-oxo-3-phenyl-1,3-thiazolidin-2-yl)phenyl]benzamide.
| Compound Name | 3-methoxy-N-[4-(4-oxo-3-phenyl-1,3-thiazolidin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 42804066 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 3-methoxy-N-[4-(4-oxo-3-phenyl-1,3-thiazolidin-2-yl)phenyl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(C3SCC(=O)N3c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H20N2O3S/c1-28-20-9-5-6-17(14-20)22(27)24-18-12-10-16(11-13-18)23-25(21(26)15-29-23)19-7-3-2-4-8-19/h2-14,23H,15H2,1H3,(H,24,27) |
| InChIKey | MRXPGMNKRPWNRR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |