C23H21N3O5S — CID 170045471
N-hydroxy-3-[[3-[3-(3-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]carbamoyl]benzeneamine oxide (PubChem CID 170045471) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is N-hydroxy-3-[[3-[3-(3-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]carbamoyl]benzeneamine oxide.
| Compound Name | N-hydroxy-3-[[3-[3-(3-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]carbamoyl]benzeneamine oxide |
|---|---|
| PubChem CID | 170045471 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | N-hydroxy-3-[[3-[3-(3-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]carbamoyl]benzeneamine oxide |
| SMILES | COc1cccc(N2C(=O)CSC2c2cccc(NC(=O)c3cccc([NH+]([O-])O)c3)c2)c1 |
| InChI | InChI=1S/C23H21N3O5S/c1-31-20-10-4-8-18(13-20)25-21(27)14-32-23(25)16-6-2-7-17(11-16)24-22(28)15-5-3-9-19(12-15)26(29)30/h2-13,23,26,29H,14H2,1H3,(H,24,28) |
| InChIKey | KXVMCBCHPSEMBD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 106.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|