C17H15NO4S — CID 3445359
3-[2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 3445359) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 3-[2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 3445359 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | COc1ccc(C2SCC(=O)N2c2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C17H15NO4S/c1-22-14-7-5-11(6-8-14)16-18(15(19)10-23-16)13-4-2-3-12(9-13)17(20)21/h2-9,16H,10H2,1H3,(H,20,21) |
| InChIKey | RZXLXYBJMSQEIF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |