C33H36O2S — CID 144752358
5-[3-[2-(4-hexylphenyl)-3-(2-phenylethynyl)cyclopent-2-en-1-yl]propyl]thiophene-2-carboxylic acid (PubChem CID 144752358) has the molecular formula C33H36O2S and a molecular weight of 496.72 g/mol. Its IUPAC name is 5-[3-[2-(4-hexylphenyl)-3-(2-phenylethynyl)cyclopent-2-en-1-yl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[2-(4-hexylphenyl)-3-(2-phenylethynyl)cyclopent-2-en-1-yl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 144752358 |
| Molecular Formula | C33H36O2S |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 5-[3-[2-(4-hexylphenyl)-3-(2-phenylethynyl)cyclopent-2-en-1-yl]propyl]thiophene-2-carboxylic acid |
| SMILES | CCCCCCc1ccc(C2=C(C#Cc3ccccc3)CCC2CCCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C33H36O2S/c1-2-3-4-6-12-26-16-19-28(20-17-26)32-27(13-9-14-30-23-24-31(36-30)33(34)35)21-22-29(32)18-15-25-10-7-5-8-11-25/h5,7-8,10-11,16-17,19-20,23-24,27H,2-4,6,9,12-14,21-22H2,1H3,(H,34,35) |
| InChIKey | ADNGACKBEHWAAV-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|