C25H31FO3S — CID 59355164
5-[3-[3-fluoro-2-[4-(1-hydroxyhexyl)phenyl]cyclopent-2-en-1-yl]propyl]thiophene-2-carboxylic acid (PubChem CID 59355164) has the molecular formula C25H31FO3S and a molecular weight of 430.59 g/mol. Its IUPAC name is 5-[3-[3-fluoro-2-[4-(1-hydroxyhexyl)phenyl]cyclopent-2-en-1-yl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[3-fluoro-2-[4-(1-hydroxyhexyl)phenyl]cyclopent-2-en-1-yl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 59355164 |
| Molecular Formula | C25H31FO3S |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 5-[3-[3-fluoro-2-[4-(1-hydroxyhexyl)phenyl]cyclopent-2-en-1-yl]propyl]thiophene-2-carboxylic acid |
| SMILES | CCCCCC(O)c1ccc(C2=C(F)CCC2CCCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C25H31FO3S/c1-2-3-4-8-22(27)17-9-11-19(12-10-17)24-18(13-15-21(24)26)6-5-7-20-14-16-23(30-20)25(28)29/h9-12,14,16,18,22,27H,2-8,13,15H2,1H3,(H,28,29) |
| InChIKey | QDJYYSGWZGMGOI-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|