C28H35NO4S — CID 59355068
2-hydroxyethyl 5-[3-[2-[4-(1-hydroxyhexyl)phenyl]-3-isocyanocyclopent-2-en-1-yl]propyl]thiophene-2-carboxylate (PubChem CID 59355068) has the molecular formula C28H35NO4S and a molecular weight of 481.66 g/mol. Its IUPAC name is 2-hydroxyethyl 5-[3-[2-[4-(1-hydroxyhexyl)phenyl]-3-isocyanocyclopent-2-en-1-yl]propyl]thiophene-2-carboxylate.
| Compound Name | 2-hydroxyethyl 5-[3-[2-[4-(1-hydroxyhexyl)phenyl]-3-isocyanocyclopent-2-en-1-yl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 59355068 |
| Molecular Formula | C28H35NO4S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 2-hydroxyethyl 5-[3-[2-[4-(1-hydroxyhexyl)phenyl]-3-isocyanocyclopent-2-en-1-yl]propyl]thiophene-2-carboxylate |
| SMILES | [C-]#[N+]C1=C(c2ccc(C(O)CCCCC)cc2)C(CCCc2ccc(C(=O)OCCO)s2)CC1 |
| InChI | InChI=1S/C28H35NO4S/c1-3-4-5-9-25(31)20-10-12-22(13-11-20)27-21(14-16-24(27)29-2)7-6-8-23-15-17-26(34-23)28(32)33-19-18-30/h10-13,15,17,21,25,30-31H,3-9,14,16,18-19H2,1H3 |
| InChIKey | PSKUOQJMSCWHBS-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 71.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|