C26H34O4S — CID 25211110
methyl 5-[3-[(2S)-2-[4-[(1S)-1-hydroxyhexyl]phenyl]-3-oxocyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 25211110) has the molecular formula C26H34O4S and a molecular weight of 442.62 g/mol. Its IUPAC name is methyl 5-[3-[(2S)-2-[4-[(1S)-1-hydroxyhexyl]phenyl]-3-oxocyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[(2S)-2-[4-[(1S)-1-hydroxyhexyl]phenyl]-3-oxocyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 25211110 |
| Molecular Formula | C26H34O4S |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | methyl 5-[3-[(2S)-2-[4-[(1S)-1-hydroxyhexyl]phenyl]-3-oxocyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | CCCCC[C@H](O)c1ccc([C@H]2C(=O)CCC2CCCc2ccc(C(=O)OC)s2)cc1 |
| InChI | InChI=1S/C26H34O4S/c1-3-4-5-9-22(27)18-10-12-20(13-11-18)25-19(14-16-23(25)28)7-6-8-21-15-17-24(31-21)26(29)30-2/h10-13,15,17,19,22,25,27H,3-9,14,16H2,1-2H3/t19?,22-,25-/m0/s1 |
| InChIKey | WJAOXKIMMSZGNH-ZJSQPSORSA-N |
| XLogP | 6.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|