C28H42O3S — CID 143727954
(1R)-1-[4-(cyclopenten-1-yl)phenyl]hexan-1-ol;ethane;methyl 5-propylthiophene-2-carboxylate (PubChem CID 143727954) has the molecular formula C28H42O3S and a molecular weight of 458.71 g/mol. Its IUPAC name is (1R)-1-[4-(cyclopenten-1-yl)phenyl]hexan-1-ol;ethane;methyl 5-propylthiophene-2-carboxylate.
| Compound Name | (1R)-1-[4-(cyclopenten-1-yl)phenyl]hexan-1-ol;ethane;methyl 5-propylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 143727954 |
| Molecular Formula | C28H42O3S |
| Molecular Weight | 458.71 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | (1R)-1-[4-(cyclopenten-1-yl)phenyl]hexan-1-ol;ethane;methyl 5-propylthiophene-2-carboxylate |
| SMILES | CC.CCCCC[C@@H](O)c1ccc(C2=CCCC2)cc1.CCCc1ccc(C(=O)OC)s1 |
| InChI | InChI=1S/C17H24O.C9H12O2S.C2H6/c1-2-3-4-9-17(18)16-12-10-15(11-13-16)14-7-5-6-8-14;1-3-4-7-5-6-8(12-7)9(10)11-2;1-2/h7,10-13,17-18H,2-6,8-9H2,1H3;5-6H,3-4H2,1-2H3;1-2H3/t17-;;/m1../s1 |
| InChIKey | NHEYPNLKEDCHBR-ZEECNFPPSA-N |
| XLogP | 8.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.71 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|