C30H45NO8S — CID 145057691
1-[4-[(1S)-1-hydroxyhexyl]phenyl]pyrrolidin-2-one;2,3,5,6-tetrahydroxyhexyl 5-propylthiophene-2-carboxylate (PubChem CID 145057691) has the molecular formula C30H45NO8S and a molecular weight of 579.76 g/mol. Its IUPAC name is 1-[4-[(1S)-1-hydroxyhexyl]phenyl]pyrrolidin-2-one;2,3,5,6-tetrahydroxyhexyl 5-propylthiophene-2-carboxylate.
| Compound Name | 1-[4-[(1S)-1-hydroxyhexyl]phenyl]pyrrolidin-2-one;2,3,5,6-tetrahydroxyhexyl 5-propylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 145057691 |
| Molecular Formula | C30H45NO8S |
| Molecular Weight | 579.76 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | 1-[4-[(1S)-1-hydroxyhexyl]phenyl]pyrrolidin-2-one;2,3,5,6-tetrahydroxyhexyl 5-propylthiophene-2-carboxylate |
| SMILES | CCCCC[C@H](O)c1ccc(N2CCCC2=O)cc1.CCCc1ccc(C(=O)OCC(O)C(O)CC(O)CO)s1 |
| InChI | InChI=1S/C16H23NO2.C14H22O6S/c1-2-3-4-6-15(18)13-8-10-14(11-9-13)17-12-5-7-16(17)19;1-2-3-10-4-5-13(21-10)14(19)20-8-12(18)11(17)6-9(16)7-15/h8-11,15,18H,2-7,12H2,1H3;4-5,9,11-12,15-18H,2-3,6-8H2,1H3/t15-;/m0./s1 |
| InChIKey | SNWYALUGZYKKMY-RSAXXLAASA-N |
| XLogP | 3.75 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.76 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|