C27H35NO5 — CID 143545914
acetylene;1-[4-(1-hydroxyheptan-2-yl)phenyl]pyrrolidin-2-one;4-methoxybenzoic acid (PubChem CID 143545914) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is acetylene;1-[4-(1-hydroxyheptan-2-yl)phenyl]pyrrolidin-2-one;4-methoxybenzoic acid.
| Compound Name | acetylene;1-[4-(1-hydroxyheptan-2-yl)phenyl]pyrrolidin-2-one;4-methoxybenzoic acid |
|---|---|
| PubChem CID | 143545914 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | acetylene;1-[4-(1-hydroxyheptan-2-yl)phenyl]pyrrolidin-2-one;4-methoxybenzoic acid |
| SMILES | C#C.CCCCCC(CO)c1ccc(N2CCCC2=O)cc1.COc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H25NO2.C8H8O3.C2H2/c1-2-3-4-6-15(13-19)14-8-10-16(11-9-14)18-12-5-7-17(18)20;1-11-7-4-2-6(3-5-7)8(9)10;1-2/h8-11,15,19H,2-7,12-13H2,1H3;2-5H,1H3,(H,9,10);1-2H |
| InChIKey | SXRURILKKASYTH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|